C16H29N3O4 — CID 120888945
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 120888945) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 120888945 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | COCC1(CNC(=O)CCC(=O)N2CCOCC2)CCNCC1 |
| InChI | InChI=1S/C16H29N3O4/c1-22-13-16(4-6-17-7-5-16)12-18-14(20)2-3-15(21)19-8-10-23-11-9-19/h17H,2-13H2,1H3,(H,18,20) |
| InChIKey | DZSKQKGZJANGJV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |