C16H24BrClN2O3 — CID 120890726
4-bromo-2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzamide;hydrochloride (PubChem CID 120890726) has the molecular formula C16H24BrClN2O3 and a molecular weight of 407.74 g/mol. Its IUPAC name is 4-bromo-2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzamide;hydrochloride.
| Compound Name | 4-bromo-2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120890726 |
| Molecular Formula | C16H24BrClN2O3 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 4-bromo-2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzamide;hydrochloride |
| SMILES | COCC1(CNC(=O)c2ccc(Br)cc2OC)CCNCC1.Cl |
| InChI | InChI=1S/C16H23BrN2O3.ClH/c1-21-11-16(5-7-18-8-6-16)10-19-15(20)13-4-3-12(17)9-14(13)22-2;/h3-4,9,18H,5-8,10-11H2,1-2H3,(H,19,20);1H |
| InChIKey | QOGIQOUNBHKHLU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |