C21H32N2O3 — CID 120891099
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1-(3-methoxyphenyl)cyclopentane-1-carboxamide (PubChem CID 120891099) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1-(3-methoxyphenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1-(3-methoxyphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 120891099 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-1-(3-methoxyphenyl)cyclopentane-1-carboxamide |
| SMILES | COCC1(CNC(=O)C2(c3cccc(OC)c3)CCCC2)CCNCC1 |
| InChI | InChI=1S/C21H32N2O3/c1-25-16-20(10-12-22-13-11-20)15-23-19(24)21(8-3-4-9-21)17-6-5-7-18(14-17)26-2/h5-7,14,22H,3-4,8-13,15-16H2,1-2H3,(H,23,24) |
| InChIKey | RYUJDPOQYZNRGH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |