About 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride
3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride (PubChem CID 120893922) has the molecular formula C14H17ClFN3O
and a molecular weight of 297.76 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride.
Molecular Properties
| Compound Name | 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride |
| PubChem CID | 120893922 |
| Molecular Formula | C14H17ClFN3O |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cl.Fc1cccc(Cc2noc([C@H]3CCCCN3)n2)c1 |
| InChI | InChI=1S/C14H16FN3O.ClH/c15-11-5-3-4-10(8-11)9-13-17-14(19-18-13)12-6-1-2-7-16-12;/h3-5,8,12,16H,1-2,6-7,9H2;1H/t12-;/m1./s1 |
| InChIKey | DLNDUGHQGNOFSD-UTONKHPSSA-N |
| XLogP | 3.04 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride?
The IUPAC name of 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride (CID 120893922) is 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride.
What is the SMILES notation for 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride?
The canonical SMILES for 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride is Cl.Fc1cccc(Cc2noc([C@H]3CCCCN3)n2)c1.
What is the InChIKey of 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride?
The InChIKey is DLNDUGHQGNOFSD-UTONKHPSSA-N. The full InChI is InChI=1S/C14H16FN3O.ClH/c15-11-5-3-4-10(8-11)9-13-17-14(19-18-13)12-6-1-2-7-16-12;/h3-5,8,12,16H,1-2,6-7,9H2;1H/t12-;/m1./s1.
What are the key properties of 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride?
3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride has a molecular weight of 297.76 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-fluorophenyl)methyl]-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride is sourced from PubChem (CID 120893922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).