C19H26N4O3S — CID 120895508
N-(2-aminoethyl)-N-(2-phenylethyl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide (PubChem CID 120895508) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2-phenylethyl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-(2-phenylethyl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 120895508 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(2-aminoethyl)-N-(2-phenylethyl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide |
| SMILES | NCCN(CCc1ccccc1)S(=O)(=O)c1c[nH]c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H26N4O3S/c20-9-13-23(12-8-16-6-2-1-3-7-16)27(25,26)17-14-18(21-15-17)19(24)22-10-4-5-11-22/h1-3,6-7,14-15,21H,4-5,8-13,20H2 |
| InChIKey | MYCFVJWEGOEQJZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |