C16H18F3N3O2S — CID 120895656
N-(2-aminoethyl)-N-(2-phenylethyl)-4-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 120895656) has the molecular formula C16H18F3N3O2S and a molecular weight of 373.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2-phenylethyl)-4-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-(2-phenylethyl)-4-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 120895656 |
| Molecular Formula | C16H18F3N3O2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-(2-aminoethyl)-N-(2-phenylethyl)-4-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | NCCN(CCc1ccccc1)S(=O)(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O2S/c17-16(18,19)14-6-9-21-12-15(14)25(23,24)22(11-8-20)10-7-13-4-2-1-3-5-13/h1-6,9,12H,7-8,10-11,20H2 |
| InChIKey | KEGBIFRJSWHFLW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |