About [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate
[2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate (PubChem CID 1208967) has the molecular formula C14H10BrIN2O4S
and a molecular weight of 509.12 g/mol. Its IUPAC name is [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate.
Molecular Properties
| Compound Name | [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate |
| PubChem CID | 1208967 |
| Molecular Formula | C14H10BrIN2O4S |
| Molecular Weight | 509.12 g/mol |
| Exact Mass | 507.86 |
| IUPAC Name | [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate |
| SMILES | CC(=O)NC1=NC(=O)C(=Cc2cc(Br)cc(I)c2OC(C)=O)S1 |
| InChI | InChI=1S/C14H10BrIN2O4S/c1-6(19)17-14-18-13(21)11(23-14)4-8-3-9(15)5-10(16)12(8)22-7(2)20/h3-5H,1-2H3,(H,17,18,19,21) |
| InChIKey | GRCKZTIDDZHSIN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate?
The IUPAC name of [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate (CID 1208967) is [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate.
What is the SMILES notation for [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate?
The canonical SMILES for [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate is CC(=O)NC1=NC(=O)C(=Cc2cc(Br)cc(I)c2OC(C)=O)S1.
What is the InChIKey of [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate?
The InChIKey is GRCKZTIDDZHSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrIN2O4S/c1-6(19)17-14-18-13(21)11(23-14)4-8-3-9(15)5-10(16)12(8)22-7(2)20/h3-5H,1-2H3,(H,17,18,19,21).
What are the key properties of [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate?
[2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate has a molecular weight of 509.12 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromo-6-iodophenyl] acetate is sourced from PubChem (CID 1208967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).