C12H19ClN2S — CID 120897041
1-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-2-yl]ethanamine (PubChem CID 120897041) has the molecular formula C12H19ClN2S and a molecular weight of 258.82 g/mol. Its IUPAC name is 1-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-2-yl]ethanamine.
| Compound Name | 1-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 120897041 |
| Molecular Formula | C12H19ClN2S |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-[1-[(2-chlorothiophen-3-yl)methyl]piperidin-2-yl]ethanamine |
| SMILES | CC(N)C1CCCCN1Cc1ccsc1Cl |
| InChI | InChI=1S/C12H19ClN2S/c1-9(14)11-4-2-3-6-15(11)8-10-5-7-16-12(10)13/h5,7,9,11H,2-4,6,8,14H2,1H3 |
| InChIKey | BYYIYJBZYLSVAB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |