C15H31ClN2 — CID 120898331
4-ethyl-N-methyl-N-[(3-methylpyrrolidin-3-yl)methyl]cyclohexan-1-amine;hydrochloride (PubChem CID 120898331) has the molecular formula C15H31ClN2 and a molecular weight of 274.88 g/mol. Its IUPAC name is 4-ethyl-N-methyl-N-[(3-methylpyrrolidin-3-yl)methyl]cyclohexan-1-amine;hydrochloride.
| Compound Name | 4-ethyl-N-methyl-N-[(3-methylpyrrolidin-3-yl)methyl]cyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120898331 |
| Molecular Formula | C15H31ClN2 |
| Molecular Weight | 274.88 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 4-ethyl-N-methyl-N-[(3-methylpyrrolidin-3-yl)methyl]cyclohexan-1-amine;hydrochloride |
| SMILES | CCC1CCC(N(C)CC2(C)CCNC2)CC1.Cl |
| InChI | InChI=1S/C15H30N2.ClH/c1-4-13-5-7-14(8-6-13)17(3)12-15(2)9-10-16-11-15;/h13-14,16H,4-12H2,1-3H3;1H |
| InChIKey | ZGTJHPLBJOCAJU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.88 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |