C15H19N3OS — CID 120899230
5-[(2-methyl-6-phenylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 120899230) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 5-[(2-methyl-6-phenylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-methyl-6-phenylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120899230 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-[(2-methyl-6-phenylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CC1CN(Cc2cnc(N)s2)CC(c2ccccc2)O1 |
| InChI | InChI=1S/C15H19N3OS/c1-11-8-18(9-13-7-17-15(16)20-13)10-14(19-11)12-5-3-2-4-6-12/h2-7,11,14H,8-10H2,1H3,(H2,16,17) |
| InChIKey | YTCIFHKASDAQCC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |