About 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride
2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride (PubChem CID 120899398) has the molecular formula C11H22ClF3N2O
and a molecular weight of 290.76 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride |
| PubChem CID | 120899398 |
| Molecular Formula | C11H22ClF3N2O |
| Molecular Weight | 290.76 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride |
| SMILES | COCCN(CC(F)(F)F)CC1(C)CCNC1.Cl |
| InChI | InChI=1S/C11H21F3N2O.ClH/c1-10(3-4-15-7-10)8-16(5-6-17-2)9-11(12,13)14;/h15H,3-9H2,1-2H3;1H |
| InChIKey | CKMCVNVEFIMBIL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride?
The IUPAC name of 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride (CID 120899398) is 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride.
What is the SMILES notation for 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride?
The canonical SMILES for 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride is COCCN(CC(F)(F)F)CC1(C)CCNC1.Cl.
What is the InChIKey of 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride?
The InChIKey is CKMCVNVEFIMBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2O.ClH/c1-10(3-4-15-7-10)8-16(5-6-17-2)9-11(12,13)14;/h15H,3-9H2,1-2H3;1H.
What are the key properties of 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride?
2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride has a molecular weight of 290.76 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-(2-methoxyethyl)-N-[(3-methylpyrrolidin-3-yl)methyl]ethanamine;hydrochloride is sourced from PubChem (CID 120899398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).