About methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate
methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate (PubChem CID 120899411) has the molecular formula C17H22N4O2S
and a molecular weight of 346.46 g/mol. Its IUPAC name is methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate |
| PubChem CID | 120899411 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(Cc3cnc(N)s3)C(C)C2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-12-10-21(14-5-3-13(4-6-14)16(22)23-2)8-7-20(12)11-15-9-19-17(18)24-15/h3-6,9,12H,7-8,10-11H2,1-2H3,(H2,18,19) |
| InChIKey | MBVMQSVXSKSVNE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate?
The IUPAC name of methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate (CID 120899411) is methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate.
What is the SMILES notation for methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate?
The canonical SMILES for methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate is COC(=O)c1ccc(N2CCN(Cc3cnc(N)s3)C(C)C2)cc1.
What is the InChIKey of methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate?
The InChIKey is MBVMQSVXSKSVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2S/c1-12-10-21(14-5-3-13(4-6-14)16(22)23-2)8-7-20(12)11-15-9-19-17(18)24-15/h3-6,9,12H,7-8,10-11H2,1-2H3,(H2,18,19).
What are the key properties of methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate?
methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate has a molecular weight of 346.46 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[(2-amino-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate is sourced from PubChem (CID 120899411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).