About 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride
1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride (PubChem CID 120899996) has the molecular formula C9H15ClN4OS
and a molecular weight of 262.77 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride |
| PubChem CID | 120899996 |
| Molecular Formula | C9H15ClN4OS |
| Molecular Weight | 262.77 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride |
| SMILES | Cl.Nc1ncc(CN2CCNC(=O)CC2)s1 |
| InChI | InChI=1S/C9H14N4OS.ClH/c10-9-12-5-7(15-9)6-13-3-1-8(14)11-2-4-13;/h5H,1-4,6H2,(H2,10,12)(H,11,14);1H |
| InChIKey | SZXJLLWSROLHIC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.77 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride?
The IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride (CID 120899996) is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride.
What is the SMILES notation for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride?
The canonical SMILES for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride is Cl.Nc1ncc(CN2CCNC(=O)CC2)s1.
What is the InChIKey of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride?
The InChIKey is SZXJLLWSROLHIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS.ClH/c10-9-12-5-7(15-9)6-13-3-1-8(14)11-2-4-13;/h5H,1-4,6H2,(H2,10,12)(H,11,14);1H.
What are the key properties of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride?
1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride has a molecular weight of 262.77 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-1,4-diazepan-5-one;hydrochloride is sourced from PubChem (CID 120899996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).