About methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride
methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride (PubChem CID 120900406) has the molecular formula C13H22ClN3O2S
and a molecular weight of 319.86 g/mol. Its IUPAC name is methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride |
| PubChem CID | 120900406 |
| Molecular Formula | C13H22ClN3O2S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1(N(C)Cc2cnc(N)s2)CCCCC1.Cl |
| InChI | InChI=1S/C13H21N3O2S.ClH/c1-16(9-10-8-15-12(14)19-10)13(11(17)18-2)6-4-3-5-7-13;/h8H,3-7,9H2,1-2H3,(H2,14,15);1H |
| InChIKey | ZYLUFYFZQRHDJM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride?
The IUPAC name of methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride (CID 120900406) is methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride.
What is the SMILES notation for methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride?
The canonical SMILES for methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride is COC(=O)C1(N(C)Cc2cnc(N)s2)CCCCC1.Cl.
What is the InChIKey of methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride?
The InChIKey is ZYLUFYFZQRHDJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2S.ClH/c1-16(9-10-8-15-12(14)19-10)13(11(17)18-2)6-4-3-5-7-13;/h8H,3-7,9H2,1-2H3,(H2,14,15);1H.
What are the key properties of methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride?
methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride has a molecular weight of 319.86 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2-amino-1,3-thiazol-5-yl)methyl-methylamino]cyclohexane-1-carboxylate;hydrochloride is sourced from PubChem (CID 120900406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).