About 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride
5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 120900861) has the molecular formula C9H13ClN4S2
and a molecular weight of 276.82 g/mol. Its IUPAC name is 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 120900861 |
| Molecular Formula | C9H13ClN4S2 |
| Molecular Weight | 276.82 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CN(Cc1cnc(N)s1)Cc1nccs1.Cl |
| InChI | InChI=1S/C9H12N4S2.ClH/c1-13(6-8-11-2-3-14-8)5-7-4-12-9(10)15-7;/h2-4H,5-6H2,1H3,(H2,10,12);1H |
| InChIKey | FZSJIJHAPVZBMO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride (CID 120900861) is 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride is CN(Cc1cnc(N)s1)Cc1nccs1.Cl.
What is the InChIKey of 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is FZSJIJHAPVZBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S2.ClH/c1-13(6-8-11-2-3-14-8)5-7-4-12-9(10)15-7;/h2-4H,5-6H2,1H3,(H2,10,12);1H.
What are the key properties of 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 276.82 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 120900861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).