About 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride
1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride (PubChem CID 120900964) has the molecular formula C9H13ClF3N3OS
and a molecular weight of 303.74 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride |
| PubChem CID | 120900964 |
| Molecular Formula | C9H13ClF3N3OS |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.Nc1ncc(CN2CCC(O)(C(F)(F)F)C2)s1 |
| InChI | InChI=1S/C9H12F3N3OS.ClH/c10-9(11,12)8(16)1-2-15(5-8)4-6-3-14-7(13)17-6;/h3,16H,1-2,4-5H2,(H2,13,14);1H |
| InChIKey | YITUMJWHZCRAJC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride?
The IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride (CID 120900964) is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride?
The canonical SMILES for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride is Cl.Nc1ncc(CN2CCC(O)(C(F)(F)F)C2)s1.
What is the InChIKey of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride?
The InChIKey is YITUMJWHZCRAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3OS.ClH/c10-9(11,12)8(16)1-2-15(5-8)4-6-3-14-7(13)17-6;/h3,16H,1-2,4-5H2,(H2,13,14);1H.
What are the key properties of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride?
1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride has a molecular weight of 303.74 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3-(trifluoromethyl)pyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 120900964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).