About methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride
methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride (PubChem CID 120901010) has the molecular formula C11H18ClN3O2S
and a molecular weight of 291.80 g/mol. Its IUPAC name is methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride |
| PubChem CID | 120901010 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride |
| SMILES | COC(=O)CC1CCCN1Cc1cnc(N)s1.Cl |
| InChI | InChI=1S/C11H17N3O2S.ClH/c1-16-10(15)5-8-3-2-4-14(8)7-9-6-13-11(12)17-9;/h6,8H,2-5,7H2,1H3,(H2,12,13);1H |
| InChIKey | NUQJZUYLQQSYDC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride?
The IUPAC name of methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride (CID 120901010) is methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride.
What is the SMILES notation for methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride?
The canonical SMILES for methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride is COC(=O)CC1CCCN1Cc1cnc(N)s1.Cl.
What is the InChIKey of methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride?
The InChIKey is NUQJZUYLQQSYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S.ClH/c1-16-10(15)5-8-3-2-4-14(8)7-9-6-13-11(12)17-9;/h6,8H,2-5,7H2,1H3,(H2,12,13);1H.
What are the key properties of methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride?
methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride has a molecular weight of 291.80 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(2-amino-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]acetate;hydrochloride is sourced from PubChem (CID 120901010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).