About 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride
2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride (PubChem CID 120901014) has the molecular formula C15H22ClN3OS
and a molecular weight of 327.88 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride |
| PubChem CID | 120901014 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride |
| SMILES | CCN(Cc1cnc(N)s1)CC(O)c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C15H21N3OS.ClH/c1-3-18(9-13-8-17-15(16)20-13)10-14(19)12-6-4-11(2)5-7-12;/h4-8,14,19H,3,9-10H2,1-2H3,(H2,16,17);1H |
| InChIKey | WCVFIIKPHQEITC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride?
The IUPAC name of 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride (CID 120901014) is 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride.
What is the SMILES notation for 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride?
The canonical SMILES for 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride is CCN(Cc1cnc(N)s1)CC(O)c1ccc(C)cc1.Cl.
What is the InChIKey of 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride?
The InChIKey is WCVFIIKPHQEITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OS.ClH/c1-3-18(9-13-8-17-15(16)20-13)10-14(19)12-6-4-11(2)5-7-12;/h4-8,14,19H,3,9-10H2,1-2H3,(H2,16,17);1H.
What are the key properties of 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride?
2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride has a molecular weight of 327.88 g/mol, XLogP of 3.01, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1,3-thiazol-5-yl)methyl-ethylamino]-1-(4-methylphenyl)ethanol;hydrochloride is sourced from PubChem (CID 120901014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).