C18H36N4 — CID 120901550
1-[(3-methylpyrrolidin-3-yl)methyl]-4-(1-propan-2-ylpiperidin-4-yl)piperazine (PubChem CID 120901550) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[(3-methylpyrrolidin-3-yl)methyl]-4-(1-propan-2-ylpiperidin-4-yl)piperazine.
| Compound Name | 1-[(3-methylpyrrolidin-3-yl)methyl]-4-(1-propan-2-ylpiperidin-4-yl)piperazine |
|---|---|
| PubChem CID | 120901550 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 1-[(3-methylpyrrolidin-3-yl)methyl]-4-(1-propan-2-ylpiperidin-4-yl)piperazine |
| SMILES | CC(C)N1CCC(N2CCN(CC3(C)CCNC3)CC2)CC1 |
| InChI | InChI=1S/C18H36N4/c1-16(2)21-8-4-17(5-9-21)22-12-10-20(11-13-22)15-18(3)6-7-19-14-18/h16-17,19H,4-15H2,1-3H3 |
| InChIKey | ZXDIXXDYJCHNPM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |