About 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride
1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride (PubChem CID 120902111) has the molecular formula C10H19ClN4O2S2
and a molecular weight of 326.88 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride |
| PubChem CID | 120902111 |
| Molecular Formula | C10H19ClN4O2S2 |
| Molecular Weight | 326.88 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride |
| SMILES | CCNS(=O)(=O)C1CCN(Cc2cnc(N)s2)C1.Cl |
| InChI | InChI=1S/C10H18N4O2S2.ClH/c1-2-13-18(15,16)9-3-4-14(7-9)6-8-5-12-10(11)17-8;/h5,9,13H,2-4,6-7H2,1H3,(H2,11,12);1H |
| InChIKey | HANQVEFFHPTHIR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.88 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride?
The IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride (CID 120902111) is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride.
What is the SMILES notation for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride?
The canonical SMILES for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride is CCNS(=O)(=O)C1CCN(Cc2cnc(N)s2)C1.Cl.
What is the InChIKey of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride?
The InChIKey is HANQVEFFHPTHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S2.ClH/c1-2-13-18(15,16)9-3-4-14(7-9)6-8-5-12-10(11)17-8;/h5,9,13H,2-4,6-7H2,1H3,(H2,11,12);1H.
What are the key properties of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride?
1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride has a molecular weight of 326.88 g/mol, XLogP of 0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-N-ethylpyrrolidine-3-sulfonamide;hydrochloride is sourced from PubChem (CID 120902111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).