About 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine
5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120903354) has the molecular formula C16H20ClN3OS
and a molecular weight of 337.88 g/mol. Its IUPAC name is 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine |
| PubChem CID | 120903354 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | CC1(C)COC(c2ccccc2Cl)CN1Cc1cnc(N)s1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-16(2)10-21-14(12-5-3-4-6-13(12)17)9-20(16)8-11-7-19-15(18)22-11/h3-7,14H,8-10H2,1-2H3,(H2,18,19) |
| InChIKey | VQAUWFXPCXNSHO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine (CID 120903354) is 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine is CC1(C)COC(c2ccccc2Cl)CN1Cc1cnc(N)s1.
What is the InChIKey of 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine?
The InChIKey is VQAUWFXPCXNSHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3OS/c1-16(2)10-21-14(12-5-3-4-6-13(12)17)9-20(16)8-11-7-19-15(18)22-11/h3-7,14H,8-10H2,1-2H3,(H2,18,19).
What are the key properties of 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine?
5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine has a molecular weight of 337.88 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(2-chlorophenyl)-5,5-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 120903354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).