About [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol
[1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol (PubChem CID 120903792) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol |
| PubChem CID | 120903792 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol |
| SMILES | CC1C(CO)CCN1Cc1cnc(N)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-7-8(6-14)2-3-13(7)5-9-4-12-10(11)15-9/h4,7-8,14H,2-3,5-6H2,1H3,(H2,11,12) |
| InChIKey | BFBYLBATGOUSGD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol?
The IUPAC name of [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol (CID 120903792) is [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol?
The canonical SMILES for [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol is CC1C(CO)CCN1Cc1cnc(N)s1.
What is the InChIKey of [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol?
The InChIKey is BFBYLBATGOUSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS/c1-7-8(6-14)2-3-13(7)5-9-4-12-10(11)15-9/h4,7-8,14H,2-3,5-6H2,1H3,(H2,11,12).
What are the key properties of [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol?
[1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol has a molecular weight of 227.33 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-amino-1,3-thiazol-5-yl)methyl]-2-methylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 120903792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).