About N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride
N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride (PubChem CID 120905833) has the molecular formula C13H23ClN4OS2
and a molecular weight of 350.94 g/mol. Its IUPAC name is N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride |
| PubChem CID | 120905833 |
| Molecular Formula | C13H23ClN4OS2 |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCCN(Cc1cnc(N)s1)C1CCSCC1.Cl |
| InChI | InChI=1S/C13H22N4OS2.ClH/c1-10(18)15-4-5-17(11-2-6-19-7-3-11)9-12-8-16-13(14)20-12;/h8,11H,2-7,9H2,1H3,(H2,14,16)(H,15,18);1H |
| InChIKey | QQLQADLIKGPPBD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride?
The IUPAC name of N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride (CID 120905833) is N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride.
What is the SMILES notation for N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride?
The canonical SMILES for N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride is CC(=O)NCCN(Cc1cnc(N)s1)C1CCSCC1.Cl.
What is the InChIKey of N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride?
The InChIKey is QQLQADLIKGPPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4OS2.ClH/c1-10(18)15-4-5-17(11-2-6-19-7-3-11)9-12-8-16-13(14)20-12;/h8,11H,2-7,9H2,1H3,(H2,14,16)(H,15,18);1H.
What are the key properties of N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride?
N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride has a molecular weight of 350.94 g/mol, XLogP of 1.98, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2-amino-1,3-thiazol-5-yl)methyl-(thian-4-yl)amino]ethyl]acetamide;hydrochloride is sourced from PubChem (CID 120905833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).