About 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride
5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride (PubChem CID 120905848) has the molecular formula C14H20ClN3S2
and a molecular weight of 329.92 g/mol. Its IUPAC name is 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride |
| PubChem CID | 120905848 |
| Molecular Formula | C14H20ClN3S2 |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride |
| SMILES | CC1CN(Cc2cnc(-c3cccs3)s2)C(C)CN1.Cl |
| InChI | InChI=1S/C14H19N3S2.ClH/c1-10-8-17(11(2)6-15-10)9-12-7-16-14(19-12)13-4-3-5-18-13;/h3-5,7,10-11,15H,6,8-9H2,1-2H3;1H |
| InChIKey | SKJQPJUGBGERIY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride?
The IUPAC name of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride (CID 120905848) is 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride.
What is the SMILES notation for 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride?
The canonical SMILES for 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride is CC1CN(Cc2cnc(-c3cccs3)s2)C(C)CN1.Cl.
What is the InChIKey of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride?
The InChIKey is SKJQPJUGBGERIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S2.ClH/c1-10-8-17(11(2)6-15-10)9-12-7-16-14(19-12)13-4-3-5-18-13;/h3-5,7,10-11,15H,6,8-9H2,1-2H3;1H.
What are the key properties of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride?
5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride has a molecular weight of 329.92 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylpiperazin-1-yl)methyl]-2-thiophen-2-yl-1,3-thiazole;hydrochloride is sourced from PubChem (CID 120905848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).