About 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine
1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine (PubChem CID 120906034) has the molecular formula C17H28N2O3
and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine |
| PubChem CID | 120906034 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine |
| SMILES | CCOc1c(OC)cc(CN2CC(C)NCC2C)cc1OC |
| InChI | InChI=1S/C17H28N2O3/c1-6-22-17-15(20-4)7-14(8-16(17)21-5)11-19-10-12(2)18-9-13(19)3/h7-8,12-13,18H,6,9-11H2,1-5H3 |
| InChIKey | WXPMKHKBABYMSJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine?
The IUPAC name of 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine (CID 120906034) is 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine.
What is the SMILES notation for 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine?
The canonical SMILES for 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine is CCOc1c(OC)cc(CN2CC(C)NCC2C)cc1OC.
What is the InChIKey of 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine?
The InChIKey is WXPMKHKBABYMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O3/c1-6-22-17-15(20-4)7-14(8-16(17)21-5)11-19-10-12(2)18-9-13(19)3/h7-8,12-13,18H,6,9-11H2,1-5H3.
What are the key properties of 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine?
1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine has a molecular weight of 308.42 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2,5-dimethylpiperazine is sourced from PubChem (CID 120906034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).