About 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine
1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine (PubChem CID 120906078) has the molecular formula C15H19Cl2N5
and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine |
| PubChem CID | 120906078 |
| Molecular Formula | C15H19Cl2N5 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine |
| SMILES | CC1CN(Cc2cn(-c3ccc(Cl)c(Cl)c3)nn2)C(C)CN1 |
| InChI | InChI=1S/C15H19Cl2N5/c1-10-7-21(11(2)6-18-10)8-12-9-22(20-19-12)13-3-4-14(16)15(17)5-13/h3-5,9-11,18H,6-8H2,1-2H3 |
| InChIKey | REMDGGUJBBXFRC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine?
The IUPAC name of 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine (CID 120906078) is 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine.
What is the SMILES notation for 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine?
The canonical SMILES for 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine is CC1CN(Cc2cn(-c3ccc(Cl)c(Cl)c3)nn2)C(C)CN1.
What is the InChIKey of 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine?
The InChIKey is REMDGGUJBBXFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N5/c1-10-7-21(11(2)6-18-10)8-12-9-22(20-19-12)13-3-4-14(16)15(17)5-13/h3-5,9-11,18H,6-8H2,1-2H3.
What are the key properties of 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine?
1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine has a molecular weight of 340.26 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]-2,5-dimethylpiperazine is sourced from PubChem (CID 120906078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).