About ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride
ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride (PubChem CID 120906103) has the molecular formula C14H23ClN2O3
and a molecular weight of 302.80 g/mol. Its IUPAC name is ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride |
| PubChem CID | 120906103 |
| Molecular Formula | C14H23ClN2O3 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(CN2CC(C)NCC2C)o1.Cl |
| InChI | InChI=1S/C14H22N2O3.ClH/c1-4-18-14(17)13-6-5-12(19-13)9-16-8-10(2)15-7-11(16)3;/h5-6,10-11,15H,4,7-9H2,1-3H3;1H |
| InChIKey | QKRGQHJZPOPXHV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride?
The IUPAC name of ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride (CID 120906103) is ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride?
The canonical SMILES for ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride is CCOC(=O)c1ccc(CN2CC(C)NCC2C)o1.Cl.
What is the InChIKey of ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride?
The InChIKey is QKRGQHJZPOPXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3.ClH/c1-4-18-14(17)13-6-5-12(19-13)9-16-8-10(2)15-7-11(16)3;/h5-6,10-11,15H,4,7-9H2,1-3H3;1H.
What are the key properties of ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride?
ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride has a molecular weight of 302.80 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(2,5-dimethylpiperazin-1-yl)methyl]furan-2-carboxylate;hydrochloride is sourced from PubChem (CID 120906103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).