About 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride
2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride (PubChem CID 120906461) has the molecular formula C16H29ClN4
and a molecular weight of 312.89 g/mol. Its IUPAC name is 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride.
Molecular Properties
| Compound Name | 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride |
| PubChem CID | 120906461 |
| Molecular Formula | C16H29ClN4 |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride |
| SMILES | CCn1nc(C)c(CN2CCC3(CCNCC3)C2)c1C.Cl |
| InChI | InChI=1S/C16H28N4.ClH/c1-4-20-14(3)15(13(2)18-20)11-19-10-7-16(12-19)5-8-17-9-6-16;/h17H,4-12H2,1-3H3;1H |
| InChIKey | RACDPWLXWDBWAG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride?
The IUPAC name of 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride (CID 120906461) is 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride.
What is the SMILES notation for 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride?
The canonical SMILES for 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride is CCn1nc(C)c(CN2CCC3(CCNCC3)C2)c1C.Cl.
What is the InChIKey of 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride?
The InChIKey is RACDPWLXWDBWAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4.ClH/c1-4-20-14(3)15(13(2)18-20)11-19-10-7-16(12-19)5-8-17-9-6-16;/h17H,4-12H2,1-3H3;1H.
What are the key properties of 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride?
2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride has a molecular weight of 312.89 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-2,8-diazaspiro[4.5]decane;hydrochloride is sourced from PubChem (CID 120906461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).