C16H23BrN2 — CID 120906603
2-[(4-bromo-2-methylphenyl)methyl]-2,8-diazaspiro[4.5]decane (PubChem CID 120906603) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 2-[(4-bromo-2-methylphenyl)methyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-[(4-bromo-2-methylphenyl)methyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 120906603 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[(4-bromo-2-methylphenyl)methyl]-2,8-diazaspiro[4.5]decane |
| SMILES | Cc1cc(Br)ccc1CN1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C16H23BrN2/c1-13-10-15(17)3-2-14(13)11-19-9-6-16(12-19)4-7-18-8-5-16/h2-3,10,18H,4-9,11-12H2,1H3 |
| InChIKey | QESZWTSLXKPGTR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |