About 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane
2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane (PubChem CID 120907139) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane |
| PubChem CID | 120907139 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane |
| SMILES | C1CC2(CCN1)CCN(CC1CCSC1)C2 |
| InChI | InChI=1S/C13H24N2S/c1-8-16-10-12(1)9-15-7-4-13(11-15)2-5-14-6-3-13/h12,14H,1-11H2 |
| InChIKey | JNDIMTAKGWCTBL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane?
The IUPAC name of 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane (CID 120907139) is 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane?
The canonical SMILES for 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane is C1CC2(CCN1)CCN(CC1CCSC1)C2.
What is the InChIKey of 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane?
The InChIKey is JNDIMTAKGWCTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2S/c1-8-16-10-12(1)9-15-7-4-13(11-15)2-5-14-6-3-13/h12,14H,1-11H2.
What are the key properties of 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane?
2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane has a molecular weight of 240.42 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiolan-3-ylmethyl)-2,8-diazaspiro[4.5]decane is sourced from PubChem (CID 120907139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).