C18H23N3 — CID 120907566
2-(quinolin-8-ylmethyl)-2,8-diazaspiro[4.5]decane (PubChem CID 120907566) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(quinolin-8-ylmethyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-(quinolin-8-ylmethyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 120907566 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-(quinolin-8-ylmethyl)-2,8-diazaspiro[4.5]decane |
| SMILES | c1cnc2c(CN3CCC4(CCNCC4)C3)cccc2c1 |
| InChI | InChI=1S/C18H23N3/c1-3-15-5-2-9-20-17(15)16(4-1)13-21-12-8-18(14-21)6-10-19-11-7-18/h1-5,9,19H,6-8,10-14H2 |
| InChIKey | SKIVVPMNVBEFTG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |