C18H22ClN3O2 — CID 120910405
1-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-pyridin-4-ylpiperazine (PubChem CID 120910405) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-pyridin-4-ylpiperazine.
| Compound Name | 1-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 120910405 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-pyridin-4-ylpiperazine |
| SMILES | COc1cc(CN2CCNCC2c2ccncc2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H22ClN3O2/c1-23-17-10-13(9-15(19)18(17)24-2)12-22-8-7-21-11-16(22)14-3-5-20-6-4-14/h3-6,9-10,16,21H,7-8,11-12H2,1-2H3 |
| InChIKey | QLPWVXPVZYXYDQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |