C15H22ClN5O — CID 120911711
6-methyl-2-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]pyridin-3-ol;hydrochloride (PubChem CID 120911711) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is 6-methyl-2-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]pyridin-3-ol;hydrochloride.
| Compound Name | 6-methyl-2-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]pyridin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120911711 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 6-methyl-2-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]pyridin-3-ol;hydrochloride |
| SMILES | Cc1ccc(O)c(CN2CCNCC2c2nccn2C)n1.Cl |
| InChI | InChI=1S/C15H21N5O.ClH/c1-11-3-4-14(21)12(18-11)10-20-8-5-16-9-13(20)15-17-6-7-19(15)2;/h3-4,6-7,13,16,21H,5,8-10H2,1-2H3;1H |
| InChIKey | IWXYOIBKTGESHB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |