About N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride
N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride (PubChem CID 120912805) has the molecular formula C17H21Cl2N3O2
and a molecular weight of 370.28 g/mol. Its IUPAC name is N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride |
| PubChem CID | 120912805 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCCN(CCc1ccccc1)Cc1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O2.ClH/c18-16-12-15(6-7-17(16)21(22)23)13-20(11-9-19)10-8-14-4-2-1-3-5-14;/h1-7,12H,8-11,13,19H2;1H |
| InChIKey | WSKCDAJZEOKOGC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride?
The IUPAC name of N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride (CID 120912805) is N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride.
What is the SMILES notation for N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride?
The canonical SMILES for N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride is Cl.NCCN(CCc1ccccc1)Cc1ccc([N+](=O)[O-])c(Cl)c1.
What is the InChIKey of N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride?
The InChIKey is WSKCDAJZEOKOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O2.ClH/c18-16-12-15(6-7-17(16)21(22)23)13-20(11-9-19)10-8-14-4-2-1-3-5-14;/h1-7,12H,8-11,13,19H2;1H.
What are the key properties of N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride?
N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride has a molecular weight of 370.28 g/mol, XLogP of 3.67, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3-chloro-4-nitrophenyl)methyl]-N'-(2-phenylethyl)ethane-1,2-diamine;hydrochloride is sourced from PubChem (CID 120912805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).