C18H26F2N2O3 — CID 120915043
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine (PubChem CID 120915043) has the molecular formula C18H26F2N2O3 and a molecular weight of 356.41 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 120915043 |
| Molecular Formula | C18H26F2N2O3 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-morpholin-3-ylcyclopentan-1-amine |
| SMILES | COc1ccc(CNC2CCCC2C2COCCN2)cc1OC(F)F |
| InChI | InChI=1S/C18H26F2N2O3/c1-23-16-6-5-12(9-17(16)25-18(19)20)10-22-14-4-2-3-13(14)15-11-24-8-7-21-15/h5-6,9,13-15,18,21-22H,2-4,7-8,10-11H2,1H3 |
| InChIKey | GJGLMHCVEQRPGM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |