C23H26N4O — CID 120916882
(3R,4S)-N,N-dibenzyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 120916882) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is (3R,4S)-N,N-dibenzyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N,N-dibenzyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120916882 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (3R,4S)-N,N-dibenzyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | Cn1cc([C@H]2CNC[C@@H]2C(=O)N(Cc2ccccc2)Cc2ccccc2)cn1 |
| InChI | InChI=1S/C23H26N4O/c1-26-17-20(12-25-26)21-13-24-14-22(21)23(28)27(15-18-8-4-2-5-9-18)16-19-10-6-3-7-11-19/h2-12,17,21-22,24H,13-16H2,1H3/t21-,22+/m1/s1 |
| InChIKey | GVPATGLMPDLGDP-YADHBBJMSA-N |
| XLogP | 2.95 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |