C17H22N4O — CID 120916999
N-(2,4-dimethylphenyl)-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120916999) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120916999 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(n3cccn3)CCNCC2)c(C)c1 |
| InChI | InChI=1S/C17H22N4O/c1-13-4-5-15(14(2)12-13)20-16(22)17(6-9-18-10-7-17)21-11-3-8-19-21/h3-5,8,11-12,18H,6-7,9-10H2,1-2H3,(H,20,22) |
| InChIKey | KWJPGWZWJIRCKX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |