About 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride
4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride (PubChem CID 120917290) has the molecular formula C13H27ClN2O4
and a molecular weight of 310.82 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride |
| PubChem CID | 120917290 |
| Molecular Formula | C13H27ClN2O4 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride |
| SMILES | COCCN(CCOC)C(=O)C1(CN)CCOCC1.Cl |
| InChI | InChI=1S/C13H26N2O4.ClH/c1-17-9-5-15(6-10-18-2)12(16)13(11-14)3-7-19-8-4-13;/h3-11,14H2,1-2H3;1H |
| InChIKey | BHKIDCXWYAUCPQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride?
The IUPAC name of 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride (CID 120917290) is 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride.
What is the SMILES notation for 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride?
The canonical SMILES for 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride is COCCN(CCOC)C(=O)C1(CN)CCOCC1.Cl.
What is the InChIKey of 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride?
The InChIKey is BHKIDCXWYAUCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4.ClH/c1-17-9-5-15(6-10-18-2)12(16)13(11-14)3-7-19-8-4-13;/h3-11,14H2,1-2H3;1H.
What are the key properties of 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride?
4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride has a molecular weight of 310.82 g/mol, XLogP of 0.29, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N,N-bis(2-methoxyethyl)oxane-4-carboxamide;hydrochloride is sourced from PubChem (CID 120917290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).