C19H27ClN4O — CID 120918940
N-[1-(4-ethylphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120918940) has the molecular formula C19H27ClN4O and a molecular weight of 362.91 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[1-(4-ethylphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120918940 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[1-(4-ethylphenyl)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCc1ccc(C(C)NC(=O)C2(n3cccn3)CCNCC2)cc1.Cl |
| InChI | InChI=1S/C19H26N4O.ClH/c1-3-16-5-7-17(8-6-16)15(2)22-18(24)19(9-12-20-13-10-19)23-14-4-11-21-23;/h4-8,11,14-15,20H,3,9-10,12-13H2,1-2H3,(H,22,24);1H |
| InChIKey | LBAQHJOHQRLCCS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |