C16H25ClN2O2S — CID 120919526
(2R,3S)-2-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 120919526) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-2-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120919526 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R,3S)-2-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | Cc1ccc(CSCCNC(=O)[C@H]2NCCO[C@@H]2C)cc1.Cl |
| InChI | InChI=1S/C16H24N2O2S.ClH/c1-12-3-5-14(6-4-12)11-21-10-8-18-16(19)15-13(2)20-9-7-17-15;/h3-6,13,15,17H,7-11H2,1-2H3,(H,18,19);1H/t13-,15+;/m1./s1 |
| InChIKey | SCOADGOTLDKABI-PBCQUBLHSA-N |
| XLogP | 2.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|