About 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine
5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine (PubChem CID 120921078) has the molecular formula C14H13FN6O
and a molecular weight of 300.30 g/mol. Its IUPAC name is 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine |
| PubChem CID | 120921078 |
| Molecular Formula | C14H13FN6O |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine |
| SMILES | Fc1cccc2ncnc(N[C@H]3COC[C@H]3n3ccnn3)c12 |
| InChI | InChI=1S/C14H13FN6O/c15-9-2-1-3-10-13(9)14(17-8-16-10)19-11-6-22-7-12(11)21-5-4-18-20-21/h1-5,8,11-12H,6-7H2,(H,16,17,19)/t11-,12+/m0/s1 |
| InChIKey | HXVANILYCNCAEF-NWDGAFQWSA-N |
| XLogP | 1.41 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine?
The IUPAC name of 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine (CID 120921078) is 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine.
What is the SMILES notation for 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine?
The canonical SMILES for 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine is Fc1cccc2ncnc(N[C@H]3COC[C@H]3n3ccnn3)c12.
What is the InChIKey of 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine?
The InChIKey is HXVANILYCNCAEF-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H13FN6O/c15-9-2-1-3-10-13(9)14(17-8-16-10)19-11-6-22-7-12(11)21-5-4-18-20-21/h1-5,8,11-12H,6-7H2,(H,16,17,19)/t11-,12+/m0/s1.
What are the key properties of 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine?
5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine has a molecular weight of 300.30 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]quinazolin-4-amine is sourced from PubChem (CID 120921078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).