About 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine
5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine (PubChem CID 120921090) has the molecular formula C10H11BrN6O
and a molecular weight of 311.14 g/mol. Its IUPAC name is 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine |
| PubChem CID | 120921090 |
| Molecular Formula | C10H11BrN6O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine |
| SMILES | Brc1cncnc1N[C@H]1COC[C@H]1n1ccnn1 |
| InChI | InChI=1S/C10H11BrN6O/c11-7-3-12-6-13-10(7)15-8-4-18-5-9(8)17-2-1-14-16-17/h1-3,6,8-9H,4-5H2,(H,12,13,15)/t8-,9+/m0/s1 |
| InChIKey | UZFOCNCTDPCBCU-DTWKUNHWSA-N |
| XLogP | 0.88 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine?
The IUPAC name of 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine (CID 120921090) is 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine.
What is the SMILES notation for 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine?
The canonical SMILES for 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine is Brc1cncnc1N[C@H]1COC[C@H]1n1ccnn1.
What is the InChIKey of 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine?
The InChIKey is UZFOCNCTDPCBCU-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H11BrN6O/c11-7-3-12-6-13-10(7)15-8-4-18-5-9(8)17-2-1-14-16-17/h1-3,6,8-9H,4-5H2,(H,12,13,15)/t8-,9+/m0/s1.
What are the key properties of 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine?
5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine has a molecular weight of 311.14 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(3R,4S)-4-(triazol-1-yl)oxolan-3-yl]pyrimidin-4-amine is sourced from PubChem (CID 120921090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).