C15H17N3O2S — CID 120923900
(2R,3S)-2-methyl-N-(5-phenyl-1,3-thiazol-2-yl)morpholine-3-carboxamide (PubChem CID 120923900) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-(5-phenyl-1,3-thiazol-2-yl)morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-(5-phenyl-1,3-thiazol-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120923900 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R,3S)-2-methyl-N-(5-phenyl-1,3-thiazol-2-yl)morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-13(16-7-8-20-10)14(19)18-15-17-9-12(21-15)11-5-3-2-4-6-11/h2-6,9-10,13,16H,7-8H2,1H3,(H,17,18,19)/t10-,13+/m1/s1 |
| InChIKey | QBNJRXHMCOACSZ-MFKMUULPSA-N |
| XLogP | 2.13 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |