About N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride
N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120923921) has the molecular formula C18H26ClN5O3S
and a molecular weight of 427.96 g/mol. Its IUPAC name is N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
| PubChem CID | 120923921 |
| Molecular Formula | C18H26ClN5O3S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)C2(n3cccn3)CCNCC2)cc1.Cl |
| InChI | InChI=1S/C18H25N5O3S.ClH/c1-2-10-21-27(25,26)16-6-4-15(5-7-16)22-17(24)18(8-12-19-13-9-18)23-14-3-11-20-23;/h3-7,11,14,19,21H,2,8-10,12-13H2,1H3,(H,22,24);1H |
| InChIKey | XUEJLXLFAKDQDI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride?
The IUPAC name of N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride (CID 120923921) is N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride.
What is the SMILES notation for N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride?
The canonical SMILES for N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride is CCCNS(=O)(=O)c1ccc(NC(=O)C2(n3cccn3)CCNCC2)cc1.Cl.
What is the InChIKey of N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride?
The InChIKey is XUEJLXLFAKDQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O3S.ClH/c1-2-10-21-27(25,26)16-6-4-15(5-7-16)22-17(24)18(8-12-19-13-9-18)23-14-3-11-20-23;/h3-7,11,14,19,21H,2,8-10,12-13H2,1H3,(H,22,24);1H.
What are the key properties of N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride?
N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride has a molecular weight of 427.96 g/mol, XLogP of 1.71, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(propylsulfamoyl)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride is sourced from PubChem (CID 120923921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).