C16H24N2O4 — CID 120924293
4-(aminomethyl)-N-[3-(2-methoxyethoxy)phenyl]oxane-4-carboxamide (PubChem CID 120924293) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-(2-methoxyethoxy)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[3-(2-methoxyethoxy)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120924293 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-(aminomethyl)-N-[3-(2-methoxyethoxy)phenyl]oxane-4-carboxamide |
| SMILES | COCCOc1cccc(NC(=O)C2(CN)CCOCC2)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-20-9-10-22-14-4-2-3-13(11-14)18-15(19)16(12-17)5-7-21-8-6-16/h2-4,11H,5-10,12,17H2,1H3,(H,18,19) |
| InChIKey | JLVYRBDUJDFHBA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|