C13H25ClN2O3 — CID 120925164
[4-(aminomethyl)oxan-4-yl]-(3-methoxypiperidin-1-yl)methanone;hydrochloride (PubChem CID 120925164) has the molecular formula C13H25ClN2O3 and a molecular weight of 292.81 g/mol. Its IUPAC name is [4-(aminomethyl)oxan-4-yl]-(3-methoxypiperidin-1-yl)methanone;hydrochloride.
| Compound Name | [4-(aminomethyl)oxan-4-yl]-(3-methoxypiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120925164 |
| Molecular Formula | C13H25ClN2O3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [4-(aminomethyl)oxan-4-yl]-(3-methoxypiperidin-1-yl)methanone;hydrochloride |
| SMILES | COC1CCCN(C(=O)C2(CN)CCOCC2)C1.Cl |
| InChI | InChI=1S/C13H24N2O3.ClH/c1-17-11-3-2-6-15(9-11)12(16)13(10-14)4-7-18-8-5-13;/h11H,2-10,14H2,1H3;1H |
| InChIKey | ODNHXXDGOGYSHS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |