C15H20Cl2N2O2 — CID 120926006
4-(aminomethyl)-N-[2-(2,3-dichlorophenyl)ethyl]oxane-4-carboxamide (PubChem CID 120926006) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(2,3-dichlorophenyl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[2-(2,3-dichlorophenyl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120926006 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(2,3-dichlorophenyl)ethyl]oxane-4-carboxamide |
| SMILES | NCC1(C(=O)NCCc2cccc(Cl)c2Cl)CCOCC1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c16-12-3-1-2-11(13(12)17)4-7-19-14(20)15(10-18)5-8-21-9-6-15/h1-3H,4-10,18H2,(H,19,20) |
| InChIKey | FCIPQZHJACXIBP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |