C18H26ClN5OS — CID 120927079
(3R,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120927079) has the molecular formula C18H26ClN5OS and a molecular weight of 395.96 g/mol. Its IUPAC name is (3R,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120927079 |
| Molecular Formula | C18H26ClN5OS |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3R,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc([C@H]2CNC[C@@H]2C(=O)Nc2nc3c(s2)CCCCCC3)cn1 |
| InChI | InChI=1S/C18H25N5OS.ClH/c1-23-11-12(8-20-23)13-9-19-10-14(13)17(24)22-18-21-15-6-4-2-3-5-7-16(15)25-18;/h8,11,13-14,19H,2-7,9-10H2,1H3,(H,21,22,24);1H/t13-,14+;/m1./s1 |
| InChIKey | VDMVALXGLDOTAA-DFQHDRSWSA-N |
| XLogP | 2.90 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |