C12H25ClN2O3 — CID 120928414
(2R,3S)-N-(2-ethoxyethyl)-N-ethyl-2-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 120928414) has the molecular formula C12H25ClN2O3 and a molecular weight of 280.80 g/mol. Its IUPAC name is (2R,3S)-N-(2-ethoxyethyl)-N-ethyl-2-methylmorpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-N-(2-ethoxyethyl)-N-ethyl-2-methylmorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120928414 |
| Molecular Formula | C12H25ClN2O3 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (2R,3S)-N-(2-ethoxyethyl)-N-ethyl-2-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | CCOCCN(CC)C(=O)[C@H]1NCCO[C@@H]1C.Cl |
| InChI | InChI=1S/C12H24N2O3.ClH/c1-4-14(7-9-16-5-2)12(15)11-10(3)17-8-6-13-11;/h10-11,13H,4-9H2,1-3H3;1H/t10-,11+;/m1./s1 |
| InChIKey | JILSGHANSAKMPU-DHXVBOOMSA-N |
| XLogP | 0.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|