C14H28ClN3O3 — CID 120929562
4-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]oxane-4-carboxamide;hydrochloride (PubChem CID 120929562) has the molecular formula C14H28ClN3O3 and a molecular weight of 321.85 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]oxane-4-carboxamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]oxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120929562 |
| Molecular Formula | C14H28ClN3O3 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(2,2-dimethylpropanoylamino)ethyl]oxane-4-carboxamide;hydrochloride |
| SMILES | CC(C)(C)C(=O)NCCNC(=O)C1(CN)CCOCC1.Cl |
| InChI | InChI=1S/C14H27N3O3.ClH/c1-13(2,3)11(18)16-6-7-17-12(19)14(10-15)4-8-20-9-5-14;/h4-10,15H2,1-3H3,(H,16,18)(H,17,19);1H |
| InChIKey | RWCYVUGPZAWFDS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|